Products 1249655-47-7

CAS 1249655-47-7 is the registry number for 3-(2,5-Dichlorobenzenesulfinyl)propanoic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

3-(2,5-dichlorophenyl)sulfinylpropanoic acid (CAS 1249655-47-7) is a chemical compound with the molecular formula C9H8Cl2O3S and a molecular weight of 267.13 g/mol. IUPAC name: 3-(2,5-dichlorophenyl)sulfinylpropanoic acid. InChIKey: QBNJIMOKEXOFNS-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8Cl2O3S
Molecular weight267.13 g/mol
IUPAC name3-(2,5-dichlorophenyl)sulfinylpropanoic acid
InChIKeyQBNJIMOKEXOFNS-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1Cl)S(=O)CCC(=O)O)Cl

Computed by PubChem (NCBI)