Products 186342-91-6
CAS 186342-91-6 is the registry number for 1-(2,4-Dichlorophenyl)-2-methanesulfonylethan-1-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
1-(2,4-dichlorophenyl)-2-methylsulfonylethanone (CAS 186342-91-6) is a chemical compound with the molecular formula C9H8Cl2O3S and a molecular weight of 267.13 g/mol. IUPAC name: 1-(2,4-dichlorophenyl)-2-methylsulfonylethanone. InChIKey: FLFKDUWSSTTXMN-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2O3S |
|---|---|
| Molecular weight | 267.13 g/mol |
| IUPAC name | 1-(2,4-dichlorophenyl)-2-methylsulfonylethanone |
| InChIKey | FLFKDUWSSTTXMN-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)CC(=O)C1=C(C=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)