CAS 1603443-25-9 appears in our catalog under these names: 3-(Chlorosulfonyl)-4,5-dimethylbenzoyl chloride, 95%, 3-(Chlorosulfonyl)-4,5-dimethylbenzoyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-chlorosulfonyl-4,5-dimethylbenzoyl chloride (CAS 1603443-25-9) is a chemical compound with the molecular formula C9H8Cl2O3S and a molecular weight of 267.13 g/mol. IUPAC name: 3-chlorosulfonyl-4,5-dimethylbenzoyl chloride. InChIKey: NLIPMLBJYCPCNV-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2O3S |
|---|---|
| Molecular weight | 267.13 g/mol |
| IUPAC name | 3-chlorosulfonyl-4,5-dimethylbenzoyl chloride |
| InChIKey | NLIPMLBJYCPCNV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1C)S(=O)(=O)Cl)C(=O)Cl |
Computed by PubChem (NCBI)