CAS 1152859-34-1 is the registry number for 3-(1,1-Dioxothiomorpholin-4-yl)phenylamine. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
3-(1,1-dioxo-1,4-thiazinan-4-yl)aniline (CAS 1152859-34-1) is a chemical compound with the molecular formula C10H14N2O2S and a molecular weight of 226.30 g/mol. IUPAC name: 3-(1,1-dioxo-1,4-thiazinan-4-yl)aniline. InChIKey: AABYCBJQCOPZML-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O2S |
|---|---|
| Molecular weight | 226.30 g/mol |
| IUPAC name | 3-(1,1-dioxo-1,4-thiazinan-4-yl)aniline |
| InChIKey | AABYCBJQCOPZML-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CCN1C2=CC=CC(=C2)N |
Computed by PubChem (NCBI)