CAS 1153069-71-6 is the registry number for Methyl 4-(propane-1-sulfonamido)benzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
Methyl 4-(propylsulfonylamino)benzoate (CAS 1153069-71-6) is a chemical compound with the molecular formula C11H15NO4S and a molecular weight of 257.31 g/mol. IUPAC name: methyl 4-(propylsulfonylamino)benzoate. InChIKey: XQRLCFHUBGBENJ-UHFFFAOYSA-N.
| Molecular formula | C11H15NO4S |
|---|---|
| Molecular weight | 257.31 g/mol |
| IUPAC name | methyl 4-(propylsulfonylamino)benzoate |
| InChIKey | XQRLCFHUBGBENJ-UHFFFAOYSA-N |
| SMILES | CCCS(=O)(=O)NC1=CC=C(C=C1)C(=O)OC |
Computed by PubChem (NCBI)