CAS 1153434-00-4 appears in our catalog under these names: 2-(3,4-Difluorophenyl)-4-methyl-1,3-thiazole-5-carboxylic acid, 95%, 2-(3,4-Difluorophenyl)-4-methyl-1,3-thiazole-5-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
2-(3,4-difluorophenyl)-4-methyl-1,3-thiazole-5-carboxylic acid (CAS 1153434-00-4) is a chemical compound with the molecular formula C11H7F2NO2S and a molecular weight of 255.24 g/mol. IUPAC name: 2-(3,4-difluorophenyl)-4-methyl-1,3-thiazole-5-carboxylic acid. InChIKey: VJGGFJCKKIOYDW-UHFFFAOYSA-N.
| Molecular formula | C11H7F2NO2S |
|---|---|
| Molecular weight | 255.24 g/mol |
| IUPAC name | 2-(3,4-difluorophenyl)-4-methyl-1,3-thiazole-5-carboxylic acid |
| InChIKey | VJGGFJCKKIOYDW-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)C2=CC(=C(C=C2)F)F)C(=O)O |
Computed by PubChem (NCBI)