CAS 1545658-35-2 is the registry number for Methyl 2-(3,4-difluorophenyl)thiazole-4-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-(3,4-difluorophenyl)-1,3-thiazole-4-carboxylate (CAS 1545658-35-2) is a chemical compound with the molecular formula C11H7F2NO2S and a molecular weight of 255.24 g/mol. IUPAC name: methyl 2-(3,4-difluorophenyl)-1,3-thiazole-4-carboxylate. InChIKey: KHICGUCFMWBLNE-UHFFFAOYSA-N.
| Molecular formula | C11H7F2NO2S |
|---|---|
| Molecular weight | 255.24 g/mol |
| IUPAC name | methyl 2-(3,4-difluorophenyl)-1,3-thiazole-4-carboxylate |
| InChIKey | KHICGUCFMWBLNE-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CSC(=N1)C2=CC(=C(C=C2)F)F |
Computed by PubChem (NCBI)