CAS 1156584-75-6 appears in our catalog under these names: 2-(2-(3,4-Difluorophenyl)-1,3-thiazol-4-yl)acetic acid, 95%, 2-(2-(3,4-Difluorophenyl)-1,3-thiazol-4-yl)acetic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
2-[2-(3,4-difluorophenyl)-1,3-thiazol-4-yl]acetic acid (CAS 1156584-75-6) is a chemical compound with the molecular formula C11H7F2NO2S and a molecular weight of 255.24 g/mol. IUPAC name: 2-[2-(3,4-difluorophenyl)-1,3-thiazol-4-yl]acetic acid. InChIKey: YMZPOYXKTZBOSW-UHFFFAOYSA-N.
| Molecular formula | C11H7F2NO2S |
|---|---|
| Molecular weight | 255.24 g/mol |
| IUPAC name | 2-[2-(3,4-difluorophenyl)-1,3-thiazol-4-yl]acetic acid |
| InChIKey | YMZPOYXKTZBOSW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=NC(=CS2)CC(=O)O)F)F |
Computed by PubChem (NCBI)