CAS 68255-71-0 appears in our catalog under these names: 1-{4-((difluoromethyl)sulfanyl)phenyl}-2,5-dihydro-1H-pyrrole-2,5-dione, 95%, 1-{4-((Difluoromethyl)sulfanyl)phenyl}-2,5-dihydro-1H-pyrrole-2,5-dione. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
1-[4-(difluoromethylsulfanyl)phenyl]pyrrole-2,5-dione (CAS 68255-71-0) is a chemical compound with the molecular formula C11H7F2NO2S and a molecular weight of 255.24 g/mol. IUPAC name: 1-[4-(difluoromethylsulfanyl)phenyl]pyrrole-2,5-dione. InChIKey: ZIEKEFYFBUWELP-UHFFFAOYSA-N.
| Molecular formula | C11H7F2NO2S |
|---|---|
| Molecular weight | 255.24 g/mol |
| IUPAC name | 1-[4-(difluoromethylsulfanyl)phenyl]pyrrole-2,5-dione |
| InChIKey | ZIEKEFYFBUWELP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2C(=O)C=CC2=O)SC(F)F |
Computed by PubChem (NCBI)