Products 1423026-60-1

CAS 1423026-60-1 appears in our catalog under these names: 4-(Difluoromethyl)-2-phenyl-1,3-thiazole-5-carboxylic acid, 95%, 4-(Difluoromethyl)-2-phenyl-1,3-thiazole-5-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.

Structural formula: {0} (CAS {1})

4-(difluoromethyl)-2-phenyl-1,3-thiazole-5-carboxylic acid (CAS 1423026-60-1) is a chemical compound with the molecular formula C11H7F2NO2S and a molecular weight of 255.24 g/mol. IUPAC name: 4-(difluoromethyl)-2-phenyl-1,3-thiazole-5-carboxylic acid. InChIKey: QWBANUPLXZVFNL-UHFFFAOYSA-N.

Identity
Molecular formulaC11H7F2NO2S
Molecular weight255.24 g/mol
IUPAC name4-(difluoromethyl)-2-phenyl-1,3-thiazole-5-carboxylic acid
InChIKeyQWBANUPLXZVFNL-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C2=NC(=C(S2)C(=O)O)C(F)F

Computed by PubChem (NCBI)