CAS 1153450-05-5 is the registry number for 6,7-Dichloro-2,3-dihydro-1-benzofuran-3-one. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
6,7-dichloro-1-benzofuran-3-one (CAS 1153450-05-5) is a chemical compound with the molecular formula C8H4Cl2O2 and a molecular weight of 203.02 g/mol. IUPAC name: 6,7-dichloro-1-benzofuran-3-one. InChIKey: PPVCDEHKMVBMGA-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2O2 |
|---|---|
| Molecular weight | 203.02 g/mol |
| IUPAC name | 6,7-dichloro-1-benzofuran-3-one |
| InChIKey | PPVCDEHKMVBMGA-UHFFFAOYSA-N |
| SMILES | C1C(=O)C2=C(O1)C(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)