CAS 1153907-60-8 appears in our catalog under these names: 2-(4-((Benzyloxy)carbonyl)piperazin-1-yl)acetic acid, 97+%, 4-Carboxymethyl-piperazine-1-carboxylic acid benzyl ester, 4-Carboxymethyl-piperazine-1-carboxylic acid benzyl ester, 97%. Offered by: AmBeed, Biosynth, Fluorochem. Available pack sizes: 5g, 0,5g, 50mg, 100mg, 250mg, 500mg, 1g, 2.5g.
2-(4-phenylmethoxycarbonylpiperazin-1-yl)acetic acid (CAS 1153907-60-8) is a chemical compound with the molecular formula C14H18N2O4 and a molecular weight of 278.30 g/mol. IUPAC name: 2-(4-phenylmethoxycarbonylpiperazin-1-yl)acetic acid. InChIKey: STKKSISOELEKGJ-UHFFFAOYSA-N.
| Molecular formula | C14H18N2O4 |
|---|---|
| Molecular weight | 278.30 g/mol |
| IUPAC name | 2-(4-phenylmethoxycarbonylpiperazin-1-yl)acetic acid |
| InChIKey | STKKSISOELEKGJ-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1CC(=O)O)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)