Products 1154196-42-5
CAS 1154196-42-5 is the registry number for 1-(2,4-Dimethylphenyl)-5-methyl-1h-pyrazole-4-carboxylic acid, 95%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 1g, 5g, 100mg, 250mg.
1-(2,4-dimethylphenyl)-5-methylpyrazole-4-carboxylic acid (CAS 1154196-42-5) is a chemical compound with the molecular formula C13H14N2O2 and a molecular weight of 230.26 g/mol. IUPAC name: 1-(2,4-dimethylphenyl)-5-methylpyrazole-4-carboxylic acid. InChIKey: KZQSTFHDRZXJJI-UHFFFAOYSA-N.
| Molecular formula | C13H14N2O2 |
|---|---|
| Molecular weight | 230.26 g/mol |
| IUPAC name | 1-(2,4-dimethylphenyl)-5-methylpyrazole-4-carboxylic acid |
| InChIKey | KZQSTFHDRZXJJI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)N2C(=C(C=N2)C(=O)O)C)C |
Computed by PubChem (NCBI)