Products 1154305-44-8
CAS 1154305-44-8 is the registry number for 1-(1,2,5-Thiadiazole-3-carboxamido)cyclohexane-1-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(1,2,5-thiadiazole-3-carbonylamino)cyclohexane-1-carboxylic acid (CAS 1154305-44-8) is a chemical compound with the molecular formula C10H13N3O3S and a molecular weight of 255.30 g/mol. IUPAC name: 1-(1,2,5-thiadiazole-3-carbonylamino)cyclohexane-1-carboxylic acid. InChIKey: LLRUKRJAADFWHO-UHFFFAOYSA-N.
| Molecular formula | C10H13N3O3S |
|---|---|
| Molecular weight | 255.30 g/mol |
| IUPAC name | 1-(1,2,5-thiadiazole-3-carbonylamino)cyclohexane-1-carboxylic acid |
| InChIKey | LLRUKRJAADFWHO-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)(C(=O)O)NC(=O)C2=NSN=C2 |
Computed by PubChem (NCBI)