CAS 953754-76-2 is the registry number for 4-((4-Aminophenyl)sulfonyl)piperazin-2-one, 90%. Offered by: AmBeed. Available pack sizes: 5g, 10g.
4-(4-aminophenyl)sulfonylpiperazin-2-one (CAS 953754-76-2) is a chemical compound with the molecular formula C10H13N3O3S and a molecular weight of 255.30 g/mol. IUPAC name: 4-(4-aminophenyl)sulfonylpiperazin-2-one. InChIKey: DPPZOCXNKWKSCK-UHFFFAOYSA-N.
| Molecular formula | C10H13N3O3S |
|---|---|
| Molecular weight | 255.30 g/mol |
| IUPAC name | 4-(4-aminophenyl)sulfonylpiperazin-2-one |
| InChIKey | DPPZOCXNKWKSCK-UHFFFAOYSA-N |
| SMILES | C1CN(CC(=O)N1)S(=O)(=O)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)