Products 1154368-75-8

CAS 1154368-75-8 is the registry number for N-(2-Chloro-1-oxopropyl)-beta-alanine Methyl Ester. Offered by: TRC. Available pack sizes: 2,5g.

Structural formula: {0} (CAS {1})

Methyl 3-(2-chloropropanoylamino)propanoate (CAS 1154368-75-8) is a chemical compound with the molecular formula C7H12ClNO3 and a molecular weight of 193.63 g/mol. IUPAC name: methyl 3-(2-chloropropanoylamino)propanoate. InChIKey: SJWGLAGOKIRYSV-UHFFFAOYSA-N.

Identity
Molecular formulaC7H12ClNO3
Molecular weight193.63 g/mol
IUPAC namemethyl 3-(2-chloropropanoylamino)propanoate
InChIKeySJWGLAGOKIRYSV-UHFFFAOYSA-N
SMILESCC(C(=O)NCCC(=O)OC)Cl

Computed by PubChem (NCBI)