CAS 2151814-86-5 is the registry number for Methyl (1S,4S)-2-oxa-5-azabicyclo[2.2.1]heptane-1-carboxylate hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (1S,4S)-2-oxa-5-azabicyclo[2.2.1]heptane-1-carboxylate;hydrochloride (CAS 2151814-86-5) is a chemical compound with the molecular formula C7H12ClNO3 and a molecular weight of 193.63 g/mol. IUPAC name: methyl (1S,4S)-2-oxa-5-azabicyclo[2.2.1]heptane-1-carboxylate;hydrochloride. InChIKey: UZCNEXGQQSRNRQ-KQBMADMWSA-N.
| Molecular formula | C7H12ClNO3 |
|---|---|
| Molecular weight | 193.63 g/mol |
| IUPAC name | methyl (1S,4S)-2-oxa-5-azabicyclo[2.2.1]heptane-1-carboxylate;hydrochloride |
| InChIKey | UZCNEXGQQSRNRQ-KQBMADMWSA-N |
| SMILES | COC(=O)[C@@]12C[C@@H](CO1)NC2.Cl |
Computed by PubChem (NCBI)