CAS 255897-13-3 is the registry number for (1S,3R,4R)-3-Hydroxy-7-azabicyclo[2.2.1]heptane-1-carboxylic acid hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S,3R,4R)-3-hydroxy-7-azabicyclo[2.2.1]heptane-1-carboxylic acid;hydrochloride (CAS 255897-13-3) is a chemical compound with the molecular formula C7H12ClNO3 and a molecular weight of 193.63 g/mol. IUPAC name: (1S,3R,4R)-3-hydroxy-7-azabicyclo[2.2.1]heptane-1-carboxylic acid;hydrochloride. InChIKey: UTWJYPKOLIWBJE-SPVONFOCSA-N.
| Molecular formula | C7H12ClNO3 |
|---|---|
| Molecular weight | 193.63 g/mol |
| IUPAC name | (1S,3R,4R)-3-hydroxy-7-azabicyclo[2.2.1]heptane-1-carboxylic acid;hydrochloride |
| InChIKey | UTWJYPKOLIWBJE-SPVONFOCSA-N |
| SMILES | C1C[C@]2(C[C@H]([C@@H]1N2)O)C(=O)O.Cl |
Computed by PubChem (NCBI)