Products 2449057-82-1

CAS 2449057-82-1 is the registry number for 2-Oxa-5-azabicyclo[2.2.2]octane-4-carboxylic acid hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-oxa-5-azabicyclo[2.2.2]octane-4-carboxylic acid;hydrochloride (CAS 2449057-82-1) is a chemical compound with the molecular formula C7H12ClNO3 and a molecular weight of 193.63 g/mol. IUPAC name: 2-oxa-5-azabicyclo[2.2.2]octane-4-carboxylic acid;hydrochloride. InChIKey: DBUPINBRZONDKL-UHFFFAOYSA-N.

Identity
Molecular formulaC7H12ClNO3
Molecular weight193.63 g/mol
IUPAC name2-oxa-5-azabicyclo[2.2.2]octane-4-carboxylic acid;hydrochloride
InChIKeyDBUPINBRZONDKL-UHFFFAOYSA-N
SMILESC1CC2(COC1CN2)C(=O)O.Cl

Computed by PubChem (NCBI)