CAS 183905-31-9 appears in our catalog under these names: Linezolid Impurity 71, (S)–N–(2–(Acetyloxy)–3–chloropropyl)acetaMide, (S)-1-Acetamido-3-chloropropan-2-yl acetate 97%, (S)-1-Acetamido-3-chloropropan-2-yl acetate, 97%, 97%, (S)-1-Acetamido-3-chloropropan-2-yl acetate, 97%. Offered by: Chemat Brand, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: on request, 100g, 10g, 25g, 500g, 1g, 5g.
[(2S)-1-acetamido-3-chloropropan-2-yl] acetate (CAS 183905-31-9) is a chemical compound with the molecular formula C7H12ClNO3 and a molecular weight of 193.63 g/mol. IUPAC name: [(2S)-1-acetamido-3-chloropropan-2-yl] acetate. InChIKey: GOJJPJCUSDMTAT-SSDOTTSWSA-N.
| Molecular formula | C7H12ClNO3 |
|---|---|
| Molecular weight | 193.63 g/mol |
| IUPAC name | [(2S)-1-acetamido-3-chloropropan-2-yl] acetate |
| InChIKey | GOJJPJCUSDMTAT-SSDOTTSWSA-N |
| SMILES | CC(=O)NC[C@@H](CCl)OC(=O)C |
Computed by PubChem (NCBI)