Products 1154374-36-3
CAS 1154374-36-3 appears in our catalog under these names: 1-(4-Cyanophenyl)-5-methyl-1H-1,2,4-triazole-3-carboxylic acid, 1-(4-Cyanophenyl)-5-methyl-1H-1,2,4-triazole-3-carboxylic acid, 98%, 1-(4-Cyanophenyl)-5-methyl-1H-1,2,4-triazole-3-carboxylic acid, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
1-(4-cyanophenyl)-5-methyl-1,2,4-triazole-3-carboxylic acid (CAS 1154374-36-3) is a chemical compound with the molecular formula C11H8N4O2 and a molecular weight of 228.21 g/mol. IUPAC name: 1-(4-cyanophenyl)-5-methyl-1,2,4-triazole-3-carboxylic acid. InChIKey: YUSXYTCQEZMQGN-UHFFFAOYSA-N.
| Molecular formula | C11H8N4O2 |
|---|---|
| Molecular weight | 228.21 g/mol |
| IUPAC name | 1-(4-cyanophenyl)-5-methyl-1,2,4-triazole-3-carboxylic acid |
| InChIKey | YUSXYTCQEZMQGN-UHFFFAOYSA-N |
| SMILES | CC1=NC(=NN1C2=CC=C(C=C2)C#N)C(=O)O |
Computed by PubChem (NCBI)