CAS 1154384-08-3 appears in our catalog under these names: 2-Chloro-1-(1,1-dioxidothiomorpholino)propan-1-one, 95%, 4-(2-Chloropropanoyl)-1-thiomorpholine-1,1-dione. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
2-chloro-1-(1,1-dioxo-1,4-thiazinan-4-yl)propan-1-one (CAS 1154384-08-3) is a chemical compound with the molecular formula C7H12ClNO3S and a molecular weight of 225.69 g/mol. IUPAC name: 2-chloro-1-(1,1-dioxo-1,4-thiazinan-4-yl)propan-1-one. InChIKey: BRWFTWQLXXUNRW-UHFFFAOYSA-N.
| Molecular formula | C7H12ClNO3S |
|---|---|
| Molecular weight | 225.69 g/mol |
| IUPAC name | 2-chloro-1-(1,1-dioxo-1,4-thiazinan-4-yl)propan-1-one |
| InChIKey | BRWFTWQLXXUNRW-UHFFFAOYSA-N |
| SMILES | CC(C(=O)N1CCS(=O)(=O)CC1)Cl |
Computed by PubChem (NCBI)