CAS 7365-23-3 appears in our catalog under these names: 2-Chloro-N-(1,1-dioxidotetrahydrothiophen-3-yl)-N-methylacetamide, 98+%, 2-Chloro-N-(1,1-dioxo-tetrahydro-1lambda(6)-thiophen-3-yl)-N-methyl-acetamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 10g, 0,5g.
2-chloro-N-(1,1-dioxothiolan-3-yl)-N-methylacetamide (CAS 7365-23-3) is a chemical compound with the molecular formula C7H12ClNO3S and a molecular weight of 225.69 g/mol. IUPAC name: 2-chloro-N-(1,1-dioxothiolan-3-yl)-N-methylacetamide. InChIKey: HGIYHXMVKRVQSW-UHFFFAOYSA-N.
| Molecular formula | C7H12ClNO3S |
|---|---|
| Molecular weight | 225.69 g/mol |
| IUPAC name | 2-chloro-N-(1,1-dioxothiolan-3-yl)-N-methylacetamide |
| InChIKey | HGIYHXMVKRVQSW-UHFFFAOYSA-N |
| SMILES | CN(C1CCS(=O)(=O)C1)C(=O)CCl |
Computed by PubChem (NCBI)