CAS 2301886-64-4 is the registry number for (R)-6-Hydroxy-2-azaspiro[3.4]octane-2-sulfonyl chloride, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(6R)-6-hydroxy-2-azaspiro[3.4]octane-2-sulfonyl chloride (CAS 2301886-64-4) is a chemical compound with the molecular formula C7H12ClNO3S and a molecular weight of 225.69 g/mol. IUPAC name: (6R)-6-hydroxy-2-azaspiro[3.4]octane-2-sulfonyl chloride. InChIKey: UVBLBNUWANADEE-ZCFIWIBFSA-N.
| Molecular formula | C7H12ClNO3S |
|---|---|
| Molecular weight | 225.69 g/mol |
| IUPAC name | (6R)-6-hydroxy-2-azaspiro[3.4]octane-2-sulfonyl chloride |
| InChIKey | UVBLBNUWANADEE-ZCFIWIBFSA-N |
| SMILES | C1CC2(C[C@@H]1O)CN(C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)