CAS 883797-57-7 is the registry number for 4-(3-Chloropropanoyl)-1-thiomorpholine-1,1-dione. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-chloro-1-(1,1-dioxo-1,4-thiazinan-4-yl)propan-1-one (CAS 883797-57-7) is a chemical compound with the molecular formula C7H12ClNO3S and a molecular weight of 225.69 g/mol. IUPAC name: 3-chloro-1-(1,1-dioxo-1,4-thiazinan-4-yl)propan-1-one. InChIKey: NGZQOLAUDIEOHC-UHFFFAOYSA-N.
| Molecular formula | C7H12ClNO3S |
|---|---|
| Molecular weight | 225.69 g/mol |
| IUPAC name | 3-chloro-1-(1,1-dioxo-1,4-thiazinan-4-yl)propan-1-one |
| InChIKey | NGZQOLAUDIEOHC-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CCN1C(=O)CCCl |
Computed by PubChem (NCBI)