CAS 790272-36-5 is the registry number for 2-Chloro-N-(3-methyl-1,1-dioxidotetrahydrothiophen-3-yl)acetamide, 98%. Offered by: AmBeed. Available pack sizes: 5g, 10g.
2-chloro-N-(3-methyl-1,1-dioxothiolan-3-yl)acetamide (CAS 790272-36-5) is a chemical compound with the molecular formula C7H12ClNO3S and a molecular weight of 225.69 g/mol. IUPAC name: 2-chloro-N-(3-methyl-1,1-dioxothiolan-3-yl)acetamide. InChIKey: FFMVOZWDRNWBKN-UHFFFAOYSA-N.
| Molecular formula | C7H12ClNO3S |
|---|---|
| Molecular weight | 225.69 g/mol |
| IUPAC name | 2-chloro-N-(3-methyl-1,1-dioxothiolan-3-yl)acetamide |
| InChIKey | FFMVOZWDRNWBKN-UHFFFAOYSA-N |
| SMILES | CC1(CCS(=O)(=O)C1)NC(=O)CCl |
Computed by PubChem (NCBI)