CAS 1154890-70-6 is the registry number for 1-(3-Methoxybenzyl)-3,5-dimethyl-1h-pyrazole-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
1-[(3-methoxyphenyl)methyl]-3,5-dimethylpyrazole-4-carboxylic acid (CAS 1154890-70-6) is a chemical compound with the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. IUPAC name: 1-[(3-methoxyphenyl)methyl]-3,5-dimethylpyrazole-4-carboxylic acid. InChIKey: AMAZYMFVHJOMNR-UHFFFAOYSA-N.
| Molecular formula | C14H16N2O3 |
|---|---|
| Molecular weight | 260.29 g/mol |
| IUPAC name | 1-[(3-methoxyphenyl)methyl]-3,5-dimethylpyrazole-4-carboxylic acid |
| InChIKey | AMAZYMFVHJOMNR-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1CC2=CC(=CC=C2)OC)C)C(=O)O |
Computed by PubChem (NCBI)