Products 36060-94-3
CAS 36060-94-3 is the registry number for N-Acetyl-d-tryptophan methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Methyl (2R)-2-acetamido-3-(1H-indol-3-yl)propanoate (CAS 36060-94-3) is a chemical compound with the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. IUPAC name: methyl (2R)-2-acetamido-3-(1H-indol-3-yl)propanoate. InChIKey: XZECNVJPYDPBAM-CYBMUJFWSA-N.
| Molecular formula | C14H16N2O3 |
|---|---|
| Molecular weight | 260.29 g/mol |
| IUPAC name | methyl (2R)-2-acetamido-3-(1H-indol-3-yl)propanoate |
| InChIKey | XZECNVJPYDPBAM-CYBMUJFWSA-N |
| SMILES | CC(=O)N[C@H](CC1=CNC2=CC=CC=C21)C(=O)OC |
Computed by PubChem (NCBI)
Synonyms:
N-Acetyl-d-tryptophan methyl ester, methyl (2R)-2-acetamido-3-(1H-indol-3-yl)propanoate, D-Tryptophan, N-acetyl-, methyl ester, (R)-Methyl 2-acetamido-3-(1H-indol-3-yl)propanoate, Tadalafil Impurity Z, Methyl D-N-acetyltryptophanate, (R)-methyl 2-acetamido-3-(1H-indol-3-yl)propanoate? (Tadalafil Impurity