Products 899710-38-4

CAS 899710-38-4 is the registry number for 3-(2-Butoxyphenyl)-1h-pyrazole-5-carboxylic acid, 90%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

3-(2-butoxyphenyl)-1H-pyrazole-5-carboxylic acid (CAS 899710-38-4) is a chemical compound with the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. IUPAC name: 3-(2-butoxyphenyl)-1H-pyrazole-5-carboxylic acid. InChIKey: QIQCBXKHCDZQHH-UHFFFAOYSA-N.

Identity
Molecular formulaC14H16N2O3
Molecular weight260.29 g/mol
IUPAC name3-(2-butoxyphenyl)-1H-pyrazole-5-carboxylic acid
InChIKeyQIQCBXKHCDZQHH-UHFFFAOYSA-N
SMILESCCCCOC1=CC=CC=C1C2=NNC(=C2)C(=O)O

Computed by PubChem (NCBI)