CAS 279218-32-5 is the registry number for Trans-benzyl 5-oxohexahydropyrrolo[3,2-b]pyrrole-1(2h)-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
Benzyl (3aS,6aR)-5-oxo-2,3,3a,4,6,6a-hexahydropyrrolo[3,2-b]pyrrole-1-carboxylate (CAS 279218-32-5) is a chemical compound with the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. IUPAC name: benzyl (3aS,6aR)-5-oxo-2,3,3a,4,6,6a-hexahydropyrrolo[3,2-b]pyrrole-1-carboxylate. InChIKey: CLSSDUTXLXOEQY-NWDGAFQWSA-N.
| Molecular formula | C14H16N2O3 |
|---|---|
| Molecular weight | 260.29 g/mol |
| IUPAC name | benzyl (3aS,6aR)-5-oxo-2,3,3a,4,6,6a-hexahydropyrrolo[3,2-b]pyrrole-1-carboxylate |
| InChIKey | CLSSDUTXLXOEQY-NWDGAFQWSA-N |
| SMILES | C1CN([C@H]2[C@H]1NC(=O)C2)C(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)