CAS 887408-93-7 appears in our catalog under these names: 3-[(3,5-Dimethyl-1h-pyrazol-1-yl)methyl]-4-methoxybenzoic acid, 95%, 3-((3,5-Dimethyl-1H-pyrazol-1-yl)methyl)-4-methoxybenzoic acid, 97+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg, 10g.
3-[(3,5-dimethylpyrazol-1-yl)methyl]-4-methoxybenzoic acid (CAS 887408-93-7) is a chemical compound with the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. IUPAC name: 3-[(3,5-dimethylpyrazol-1-yl)methyl]-4-methoxybenzoic acid. InChIKey: WSSQRQOVLIJMOC-UHFFFAOYSA-N.
| Molecular formula | C14H16N2O3 |
|---|---|
| Molecular weight | 260.29 g/mol |
| IUPAC name | 3-[(3,5-dimethylpyrazol-1-yl)methyl]-4-methoxybenzoic acid |
| InChIKey | WSSQRQOVLIJMOC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1CC2=C(C=CC(=C2)C(=O)O)OC)C |
Computed by PubChem (NCBI)