CAS 1154980-01-4 is the registry number for 2,​3-​Dihydro-benzo(b)​thiophene-​3-​sulfonamide 1,​1-​dioxide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1,1-dioxo-2,3-dihydro-1-benzothiophene-3-sulfonamide (CAS 1154980-01-4) is a chemical compound with the molecular formula C8H9NO4S2 and a molecular weight of 247.3 g/mol. IUPAC name: 1,1-dioxo-2,3-dihydro-1-benzothiophene-3-sulfonamide. InChIKey: MQGLAPWCBVZZGR-UHFFFAOYSA-N.
| Molecular formula | C8H9NO4S2 |
|---|---|
| Molecular weight | 247.3 g/mol |
| IUPAC name | 1,1-dioxo-2,3-dihydro-1-benzothiophene-3-sulfonamide |
| InChIKey | MQGLAPWCBVZZGR-UHFFFAOYSA-N |
| SMILES | C1C(C2=CC=CC=C2S1(=O)=O)S(=O)(=O)N |
Computed by PubChem (NCBI)