Products 923129-16-2

CAS 923129-16-2 is the registry number for 3-(Cyclopropylsulfamoyl)thiophene-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

3-(cyclopropylsulfamoyl)thiophene-2-carboxylic acid (CAS 923129-16-2) is a chemical compound with the molecular formula C8H9NO4S2 and a molecular weight of 247.3 g/mol. IUPAC name: 3-(cyclopropylsulfamoyl)thiophene-2-carboxylic acid. InChIKey: LMYZTCQLGNOUQX-UHFFFAOYSA-N.

Identity
Molecular formulaC8H9NO4S2
Molecular weight247.3 g/mol
IUPAC name3-(cyclopropylsulfamoyl)thiophene-2-carboxylic acid
InChIKeyLMYZTCQLGNOUQX-UHFFFAOYSA-N
SMILESC1CC1NS(=O)(=O)C2=C(SC=C2)C(=O)O

Computed by PubChem (NCBI)