Products 1707668-30-1

CAS 1707668-30-1 is the registry number for 2-(1-(Methylsulfonyl)cyclopropyl)thiazole-5-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-(1-methylsulfonylcyclopropyl)-1,3-thiazole-5-carboxylic acid (CAS 1707668-30-1) is a chemical compound with the molecular formula C8H9NO4S2 and a molecular weight of 247.3 g/mol. IUPAC name: 2-(1-methylsulfonylcyclopropyl)-1,3-thiazole-5-carboxylic acid. InChIKey: PVIVHMGMXRFXKU-UHFFFAOYSA-N.

Identity
Molecular formulaC8H9NO4S2
Molecular weight247.3 g/mol
IUPAC name2-(1-methylsulfonylcyclopropyl)-1,3-thiazole-5-carboxylic acid
InChIKeyPVIVHMGMXRFXKU-UHFFFAOYSA-N
SMILESCS(=O)(=O)C1(CC1)C2=NC=C(S2)C(=O)O

Computed by PubChem (NCBI)