CAS 1707668-30-1 is the registry number for 2-(1-(Methylsulfonyl)cyclopropyl)thiazole-5-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(1-methylsulfonylcyclopropyl)-1,3-thiazole-5-carboxylic acid (CAS 1707668-30-1) is a chemical compound with the molecular formula C8H9NO4S2 and a molecular weight of 247.3 g/mol. IUPAC name: 2-(1-methylsulfonylcyclopropyl)-1,3-thiazole-5-carboxylic acid. InChIKey: PVIVHMGMXRFXKU-UHFFFAOYSA-N.
| Molecular formula | C8H9NO4S2 |
|---|---|
| Molecular weight | 247.3 g/mol |
| IUPAC name | 2-(1-methylsulfonylcyclopropyl)-1,3-thiazole-5-carboxylic acid |
| InChIKey | PVIVHMGMXRFXKU-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1(CC1)C2=NC=C(S2)C(=O)O |
Computed by PubChem (NCBI)