CAS 1334635-32-3 is the registry number for 2,4-Dimethyl-2H-1λâ¶,3λâ¶,2-benzodithiazole-1,1,3,3-tetrone. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2,4-dimethyl-1lambda6,3lambda6,2-benzodithiazole 1,1,3,3-tetraoxide (CAS 1334635-32-3) is a chemical compound with the molecular formula C8H9NO4S2 and a molecular weight of 247.3 g/mol. IUPAC name: 2,4-dimethyl-1lambda6,3lambda6,2-benzodithiazole 1,1,3,3-tetraoxide. InChIKey: GKYJBTHOKJNVSN-UHFFFAOYSA-N.
| Molecular formula | C8H9NO4S2 |
|---|---|
| Molecular weight | 247.3 g/mol |
| IUPAC name | 2,4-dimethyl-1lambda6,3lambda6,2-benzodithiazole 1,1,3,3-tetraoxide |
| InChIKey | GKYJBTHOKJNVSN-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)S(=O)(=O)N(S2(=O)=O)C |
Computed by PubChem (NCBI)