CAS 72007-45-5 is the registry number for 1,​3-​Dihydro-​benzo(c)​thiophene-​5-​sulfonamide 2,​2-​dioxide. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2,2-dioxo-1,3-dihydro-2-benzothiophene-5-sulfonamide (CAS 72007-45-5) is a chemical compound with the molecular formula C8H9NO4S2 and a molecular weight of 247.3 g/mol. IUPAC name: 2,2-dioxo-1,3-dihydro-2-benzothiophene-5-sulfonamide. InChIKey: OKBHEHXZRRRBMC-UHFFFAOYSA-N.
| Molecular formula | C8H9NO4S2 |
|---|---|
| Molecular weight | 247.3 g/mol |
| IUPAC name | 2,2-dioxo-1,3-dihydro-2-benzothiophene-5-sulfonamide |
| InChIKey | OKBHEHXZRRRBMC-UHFFFAOYSA-N |
| SMILES | C1C2=C(CS1(=O)=O)C=C(C=C2)S(=O)(=O)N |
Computed by PubChem (NCBI)