Products 1154981-82-4
CAS 1154981-82-4 is the registry number for 6-[(2,2,2-Trifluoroethyl)carbamoyl]pyridine-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
6-(2,2,2-trifluoroethylcarbamoyl)pyridine-2-carboxylic acid (CAS 1154981-82-4) is a chemical compound with the molecular formula C9H7F3N2O3 and a molecular weight of 248.16 g/mol. IUPAC name: 6-(2,2,2-trifluoroethylcarbamoyl)pyridine-2-carboxylic acid. InChIKey: MTIQFNQDVYKEJC-UHFFFAOYSA-N.
| Molecular formula | C9H7F3N2O3 |
|---|---|
| Molecular weight | 248.16 g/mol |
| IUPAC name | 6-(2,2,2-trifluoroethylcarbamoyl)pyridine-2-carboxylic acid |
| InChIKey | MTIQFNQDVYKEJC-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)C(=O)O)C(=O)NCC(F)(F)F |
Computed by PubChem (NCBI)