CAS 26930-22-3 is the registry number for 3-Nitro-N-(2,2,2-trifluoroethyl)benzamide, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
3-nitro-N-(2,2,2-trifluoroethyl)benzamide (CAS 26930-22-3) is a chemical compound with the molecular formula C9H7F3N2O3 and a molecular weight of 248.16 g/mol. IUPAC name: 3-nitro-N-(2,2,2-trifluoroethyl)benzamide. InChIKey: RKFVGHWZEUZDGO-UHFFFAOYSA-N.
| Molecular formula | C9H7F3N2O3 |
|---|---|
| Molecular weight | 248.16 g/mol |
| IUPAC name | 3-nitro-N-(2,2,2-trifluoroethyl)benzamide |
| InChIKey | RKFVGHWZEUZDGO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])C(=O)NCC(F)(F)F |
Computed by PubChem (NCBI)