CAS 1906808-06-7 is the registry number for 6-(2,2,2-Trifluoro-acetylamino)-nicotinic acid methyl ester, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 250mg.
Methyl 6-[(2,2,2-trifluoroacetyl)amino]pyridine-3-carboxylate (CAS 1906808-06-7) is a chemical compound with the molecular formula C9H7F3N2O3 and a molecular weight of 248.16 g/mol. IUPAC name: methyl 6-[(2,2,2-trifluoroacetyl)amino]pyridine-3-carboxylate. InChIKey: AHGZZAKBGBLODE-UHFFFAOYSA-N.
| Molecular formula | C9H7F3N2O3 |
|---|---|
| Molecular weight | 248.16 g/mol |
| IUPAC name | methyl 6-[(2,2,2-trifluoroacetyl)amino]pyridine-3-carboxylate |
| InChIKey | AHGZZAKBGBLODE-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CN=C(C=C1)NC(=O)C(F)(F)F |
Computed by PubChem (NCBI)