Products 1906808-06-7

CAS 1906808-06-7 is the registry number for 6-(2,2,2-Trifluoro-acetylamino)-nicotinic acid methyl ester, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

Methyl 6-[(2,2,2-trifluoroacetyl)amino]pyridine-3-carboxylate (CAS 1906808-06-7) is a chemical compound with the molecular formula C9H7F3N2O3 and a molecular weight of 248.16 g/mol. IUPAC name: methyl 6-[(2,2,2-trifluoroacetyl)amino]pyridine-3-carboxylate. InChIKey: AHGZZAKBGBLODE-UHFFFAOYSA-N.

Identity
Molecular formulaC9H7F3N2O3
Molecular weight248.16 g/mol
IUPAC namemethyl 6-[(2,2,2-trifluoroacetyl)amino]pyridine-3-carboxylate
InChIKeyAHGZZAKBGBLODE-UHFFFAOYSA-N
SMILESCOC(=O)C1=CN=C(C=C1)NC(=O)C(F)(F)F

Computed by PubChem (NCBI)