Products 226412-59-5
CAS 226412-59-5 appears in our catalog under these names: 4-[2-(Trifluoroacetyl)hydrazino]benzoic acid, 95%, 4-(2-(2,2,2-Trifluoroacetyl)hydrazinyl)benzoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
4-[2-(2,2,2-trifluoroacetyl)hydrazinyl]benzoic acid (CAS 226412-59-5) is a chemical compound with the molecular formula C9H7F3N2O3 and a molecular weight of 248.16 g/mol. IUPAC name: 4-[2-(2,2,2-trifluoroacetyl)hydrazinyl]benzoic acid. InChIKey: PKQXKODPYNMWBR-UHFFFAOYSA-N.
| Molecular formula | C9H7F3N2O3 |
|---|---|
| Molecular weight | 248.16 g/mol |
| IUPAC name | 4-[2-(2,2,2-trifluoroacetyl)hydrazinyl]benzoic acid |
| InChIKey | PKQXKODPYNMWBR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)NNC(=O)C(F)(F)F |
Computed by PubChem (NCBI)