CAS 365425-94-1 is the registry number for N-(2,2,2-Trifluoroethyl) 4-nitrobenzamide, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
4-nitro-N-(2,2,2-trifluoroethyl)benzamide (CAS 365425-94-1) is a chemical compound with the molecular formula C9H7F3N2O3 and a molecular weight of 248.16 g/mol. IUPAC name: 4-nitro-N-(2,2,2-trifluoroethyl)benzamide. InChIKey: LNOQWKNOCVOCDX-UHFFFAOYSA-N.
| Molecular formula | C9H7F3N2O3 |
|---|---|
| Molecular weight | 248.16 g/mol |
| IUPAC name | 4-nitro-N-(2,2,2-trifluoroethyl)benzamide |
| InChIKey | LNOQWKNOCVOCDX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)NCC(F)(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)