Products 1155047-26-9
CAS 1155047-26-9 appears in our catalog under these names: 5-(5-Chlorothiophen-2-yl)-1,2,4-triazin-3-amine, 95%, 5-(5-Chlorothiophen-2-yl)-1,2,4-triazin-3-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
5-(5-chlorothiophen-2-yl)-1,2,4-triazin-3-amine (CAS 1155047-26-9) is a chemical compound with the molecular formula C7H5ClN4S and a molecular weight of 212.66 g/mol. IUPAC name: 5-(5-chlorothiophen-2-yl)-1,2,4-triazin-3-amine. InChIKey: DQTBBVWROPNYFD-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN4S |
|---|---|
| Molecular weight | 212.66 g/mol |
| IUPAC name | 5-(5-chlorothiophen-2-yl)-1,2,4-triazin-3-amine |
| InChIKey | DQTBBVWROPNYFD-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=C1)Cl)C2=CN=NC(=N2)N |
Computed by PubChem (NCBI)