Products 1909325-80-9
CAS 1909325-80-9 is the registry number for 3-(2-Chloropyridin-3-yl)-1,2,4-thiadiazol-5-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(2-chloro-3-pyridinyl)-1,2,4-thiadiazol-5-amine (CAS 1909325-80-9) is a chemical compound with the molecular formula C7H5ClN4S and a molecular weight of 212.66 g/mol. IUPAC name: 3-(2-chloro-3-pyridinyl)-1,2,4-thiadiazol-5-amine. InChIKey: UTKFJMCRUWGHGN-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN4S |
|---|---|
| Molecular weight | 212.66 g/mol |
| IUPAC name | 3-(2-chloro-3-pyridinyl)-1,2,4-thiadiazol-5-amine |
| InChIKey | UTKFJMCRUWGHGN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)Cl)C2=NSC(=N2)N |
Computed by PubChem (NCBI)