Products 1504147-20-9
CAS 1504147-20-9 is the registry number for 2-Amino-5-(3-chloro-4-pyridyl)-1,3,4-thiadiazole, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
5-(3-chloro-4-pyridinyl)-1,3,4-thiadiazol-2-amine (CAS 1504147-20-9) is a chemical compound with the molecular formula C7H5ClN4S and a molecular weight of 212.66 g/mol. IUPAC name: 5-(3-chloro-4-pyridinyl)-1,3,4-thiadiazol-2-amine. InChIKey: AKYZYXQOBIATSW-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN4S |
|---|---|
| Molecular weight | 212.66 g/mol |
| IUPAC name | 5-(3-chloro-4-pyridinyl)-1,3,4-thiadiazol-2-amine |
| InChIKey | AKYZYXQOBIATSW-UHFFFAOYSA-N |
| SMILES | C1=CN=CC(=C1C2=NN=C(S2)N)Cl |
Computed by PubChem (NCBI)