CAS 1935264-14-4 appears in our catalog under these names: 3-(3-Chloropyridin-4-yl)-1,2,4-thiadiazol-5-amine, 3-(3-Chloropyridin-4-yl)-1,2,4-thiadiazol-5-amine, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
3-(3-chloro-4-pyridinyl)-1,2,4-thiadiazol-5-amine (CAS 1935264-14-4) is a chemical compound with the molecular formula C7H5ClN4S and a molecular weight of 212.66 g/mol. IUPAC name: 3-(3-chloro-4-pyridinyl)-1,2,4-thiadiazol-5-amine. InChIKey: FBOMGLLPOGPMDR-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN4S |
|---|---|
| Molecular weight | 212.66 g/mol |
| IUPAC name | 3-(3-chloro-4-pyridinyl)-1,2,4-thiadiazol-5-amine |
| InChIKey | FBOMGLLPOGPMDR-UHFFFAOYSA-N |
| SMILES | C1=CN=CC(=C1C2=NSC(=N2)N)Cl |
Computed by PubChem (NCBI)