Products 1155072-35-7

CAS 1155072-35-7 is the registry number for 1-(2,2,2-Trifluoroethyl)-1H-pyrrole-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

1-(2,2,2-trifluoroethyl)pyrrole-2-carboxylic acid (CAS 1155072-35-7) is a chemical compound with the molecular formula C7H6F3NO2 and a molecular weight of 193.12 g/mol. IUPAC name: 1-(2,2,2-trifluoroethyl)pyrrole-2-carboxylic acid. InChIKey: JNGXGGNMWZFPHF-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6F3NO2
Molecular weight193.12 g/mol
IUPAC name1-(2,2,2-trifluoroethyl)pyrrole-2-carboxylic acid
InChIKeyJNGXGGNMWZFPHF-UHFFFAOYSA-N
SMILESC1=CN(C(=C1)C(=O)O)CC(F)(F)F

Computed by PubChem (NCBI)