CAS 1155072-35-7 is the registry number for 1-(2,2,2-Trifluoroethyl)-1H-pyrrole-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(2,2,2-trifluoroethyl)pyrrole-2-carboxylic acid (CAS 1155072-35-7) is a chemical compound with the molecular formula C7H6F3NO2 and a molecular weight of 193.12 g/mol. IUPAC name: 1-(2,2,2-trifluoroethyl)pyrrole-2-carboxylic acid. InChIKey: JNGXGGNMWZFPHF-UHFFFAOYSA-N.
| Molecular formula | C7H6F3NO2 |
|---|---|
| Molecular weight | 193.12 g/mol |
| IUPAC name | 1-(2,2,2-trifluoroethyl)pyrrole-2-carboxylic acid |
| InChIKey | JNGXGGNMWZFPHF-UHFFFAOYSA-N |
| SMILES | C1=CN(C(=C1)C(=O)O)CC(F)(F)F |
Computed by PubChem (NCBI)