CAS 2110344-75-5 is the registry number for Methyl 2-(trifluoromethyl)-1H-pyrrole-3-carboxylate, 98%. Offered by: AmBeed. Available pack sizes: 250mg, 1g.
Methyl 2-(trifluoromethyl)-1H-pyrrole-3-carboxylate (CAS 2110344-75-5) is a chemical compound with the molecular formula C7H6F3NO2 and a molecular weight of 193.12 g/mol. IUPAC name: methyl 2-(trifluoromethyl)-1H-pyrrole-3-carboxylate. InChIKey: OREJVHZMQZKVFA-UHFFFAOYSA-N.
| Molecular formula | C7H6F3NO2 |
|---|---|
| Molecular weight | 193.12 g/mol |
| IUPAC name | methyl 2-(trifluoromethyl)-1H-pyrrole-3-carboxylate |
| InChIKey | OREJVHZMQZKVFA-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(NC=C1)C(F)(F)F |
Computed by PubChem (NCBI)