CAS 130530-01-7 appears in our catalog under these names: 1-Methyl-4-(trifluoromethyl)-1h-pyrrole-3-carboxylic acid, 95%, 1-Methyl-4-(trifluoromethyl)-1H-pyrrole-3-carboxylic Acid, 1-Methyl-4-(trifluoromethyl)-1H-pyrrole-3-carboxylic acid, 98+%, 1–Methyl–4–(Trifluoromethyl)–1H–Pyrrole–3–Carboxylic Acid. Offered by: Combi-blocks, TRC, AmBeed, GLPBio, Biosynth. Available pack sizes: 250mg, 1g, 5g, 500mg, 10g, 100mg.
1-methyl-4-(trifluoromethyl)pyrrole-3-carboxylic acid (CAS 130530-01-7) is a chemical compound with the molecular formula C7H6F3NO2 and a molecular weight of 193.12 g/mol. IUPAC name: 1-methyl-4-(trifluoromethyl)pyrrole-3-carboxylic acid. InChIKey: SWIGLLMSRXLGCV-UHFFFAOYSA-N.
| Molecular formula | C7H6F3NO2 |
|---|---|
| Molecular weight | 193.12 g/mol |
| IUPAC name | 1-methyl-4-(trifluoromethyl)pyrrole-3-carboxylic acid |
| InChIKey | SWIGLLMSRXLGCV-UHFFFAOYSA-N |
| SMILES | CN1C=C(C(=C1)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)