Products 1227513-61-2
CAS 1227513-61-2 is the registry number for 2-Methoxy-6-(trifluoromethyl)pyridin-4-ol, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-methoxy-6-(trifluoromethyl)-1H-pyridin-4-one (CAS 1227513-61-2) is a chemical compound with the molecular formula C7H6F3NO2 and a molecular weight of 193.12 g/mol. IUPAC name: 2-methoxy-6-(trifluoromethyl)-1H-pyridin-4-one. InChIKey: BTISSKSFTNWHOQ-UHFFFAOYSA-N.
| Molecular formula | C7H6F3NO2 |
|---|---|
| Molecular weight | 193.12 g/mol |
| IUPAC name | 2-methoxy-6-(trifluoromethyl)-1H-pyridin-4-one |
| InChIKey | BTISSKSFTNWHOQ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=O)C=C(N1)C(F)(F)F |
Computed by PubChem (NCBI)