CAS 1368361-22-1 appears in our catalog under these names: 1-Methyl-5-(trifluoromethyl)-1h-pyrrole-2-carboxylic acid, 95%, 1-Methyl-5-(trifluoromethyl)-1H-pyrrole-2-carboxylic acid, 98+%, 1–Methyl–5–(trifluoromethyl)–1H–pyrrole–2–carboxylic acid, 1-Methyl-5-(trifluoromethyl)-1H-pyrrole-2-carboxylic acid. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth. Available pack sizes: 100mg, 1g, 5g, 250mg, 0,5g, 50mg.
1-methyl-5-(trifluoromethyl)pyrrole-2-carboxylic acid (CAS 1368361-22-1) is a chemical compound with the molecular formula C7H6F3NO2 and a molecular weight of 193.12 g/mol. IUPAC name: 1-methyl-5-(trifluoromethyl)pyrrole-2-carboxylic acid. InChIKey: BWPFELYNSHMVHN-UHFFFAOYSA-N.
| Molecular formula | C7H6F3NO2 |
|---|---|
| Molecular weight | 193.12 g/mol |
| IUPAC name | 1-methyl-5-(trifluoromethyl)pyrrole-2-carboxylic acid |
| InChIKey | BWPFELYNSHMVHN-UHFFFAOYSA-N |
| SMILES | CN1C(=CC=C1C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)